C20H21FN4O2 — CID 23588927
tert-butyl 5-(aminomethyl)-3-(4-fluorophenyl)-4-pyridin-4-ylpyrazole-1-carboxylate (PubChem CID 23588927) has the molecular formula C20H21FN4O2 and a molecular weight of 368.41 g/mol. Its IUPAC name is tert-butyl 5-(aminomethyl)-3-(4-fluorophenyl)-4-pyridin-4-ylpyrazole-1-carboxylate.
| Compound Name | tert-butyl 5-(aminomethyl)-3-(4-fluorophenyl)-4-pyridin-4-ylpyrazole-1-carboxylate |
|---|---|
| PubChem CID | 23588927 |
| Molecular Formula | C20H21FN4O2 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | tert-butyl 5-(aminomethyl)-3-(4-fluorophenyl)-4-pyridin-4-ylpyrazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1nc(-c2ccc(F)cc2)c(-c2ccncc2)c1CN |
| InChI | InChI=1S/C20H21FN4O2/c1-20(2,3)27-19(26)25-16(12-22)17(13-8-10-23-11-9-13)18(24-25)14-4-6-15(21)7-5-14/h4-11H,12,22H2,1-3H3 |
| InChIKey | XBUAEVWAFMFUIH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |