C24H26FN3O3 — CID 174568523
tert-butyl carbamate;2-(4-fluorophenyl)-N-(4-pyridin-4-ylphenyl)acetamide (PubChem CID 174568523) has the molecular formula C24H26FN3O3 and a molecular weight of 423.49 g/mol. Its IUPAC name is tert-butyl carbamate;2-(4-fluorophenyl)-N-(4-pyridin-4-ylphenyl)acetamide.
| Compound Name | tert-butyl carbamate;2-(4-fluorophenyl)-N-(4-pyridin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 174568523 |
| Molecular Formula | C24H26FN3O3 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | tert-butyl carbamate;2-(4-fluorophenyl)-N-(4-pyridin-4-ylphenyl)acetamide |
| SMILES | CC(C)(C)OC(N)=O.O=C(Cc1ccc(F)cc1)Nc1ccc(-c2ccncc2)cc1 |
| InChI | InChI=1S/C19H15FN2O.C5H11NO2/c20-17-5-1-14(2-6-17)13-19(23)22-18-7-3-15(4-8-18)16-9-11-21-12-10-16;1-5(2,3)8-4(6)7/h1-12H,13H2,(H,22,23);1-3H3,(H2,6,7) |
| InChIKey | KVFOIABXOTXPNG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |