C19H17FN6O — CID 123384692
N-[4-[5-(diaminomethylideneamino)pyrazin-2-yl]phenyl]-2-(4-fluorophenyl)acetamide (PubChem CID 123384692) has the molecular formula C19H17FN6O and a molecular weight of 364.38 g/mol. Its IUPAC name is N-[4-[5-(diaminomethylideneamino)pyrazin-2-yl]phenyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[4-[5-(diaminomethylideneamino)pyrazin-2-yl]phenyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 123384692 |
| Molecular Formula | C19H17FN6O |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | N-[4-[5-(diaminomethylideneamino)pyrazin-2-yl]phenyl]-2-(4-fluorophenyl)acetamide |
| SMILES | NC(N)=Nc1cnc(-c2ccc(NC(=O)Cc3ccc(F)cc3)cc2)cn1 |
| InChI | InChI=1S/C19H17FN6O/c20-14-5-1-12(2-6-14)9-18(27)25-15-7-3-13(4-8-15)16-10-24-17(11-23-16)26-19(21)22/h1-8,10-11H,9H2,(H,25,27)(H4,21,22,24,26) |
| InChIKey | KHMMIHRTUNCENU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|