C28H26FN5O2 — CID 123953601
N-[4-[6-[[amino-(2-methoxy-4-methylanilino)methylidene]amino]-3-pyridinyl]phenyl]-2-(4-fluorophenyl)acetamide (PubChem CID 123953601) has the molecular formula C28H26FN5O2 and a molecular weight of 483.55 g/mol. Its IUPAC name is N-[4-[6-[[amino-(2-methoxy-4-methylanilino)methylidene]amino]-3-pyridinyl]phenyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[4-[6-[[amino-(2-methoxy-4-methylanilino)methylidene]amino]-3-pyridinyl]phenyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 123953601 |
| Molecular Formula | C28H26FN5O2 |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | N-[4-[6-[[amino-(2-methoxy-4-methylanilino)methylidene]amino]-3-pyridinyl]phenyl]-2-(4-fluorophenyl)acetamide |
| SMILES | COc1cc(C)ccc1N/C(N)=N/c1ccc(-c2ccc(NC(=O)Cc3ccc(F)cc3)cc2)cn1 |
| InChI | InChI=1S/C28H26FN5O2/c1-18-3-13-24(25(15-18)36-2)33-28(30)34-26-14-8-21(17-31-26)20-6-11-23(12-7-20)32-27(35)16-19-4-9-22(29)10-5-19/h3-15,17H,16H2,1-2H3,(H,32,35)(H3,30,31,33,34) |
| InChIKey | UCYSVPGTXMAZCU-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|