C31H28F2N6O3 — CID 123825893
N-[4-[6-[[amino-[4-(3-fluoroazetidine-1-carbonyl)-2-methoxyanilino]methylidene]amino]-3-pyridinyl]phenyl]-2-(4-fluorophenyl)acetamide (PubChem CID 123825893) has the molecular formula C31H28F2N6O3 and a molecular weight of 570.60 g/mol. Its IUPAC name is N-[4-[6-[[amino-[4-(3-fluoroazetidine-1-carbonyl)-2-methoxyanilino]methylidene]amino]-3-pyridinyl]phenyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[4-[6-[[amino-[4-(3-fluoroazetidine-1-carbonyl)-2-methoxyanilino]methylidene]amino]-3-pyridinyl]phenyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 123825893 |
| Molecular Formula | C31H28F2N6O3 |
| Molecular Weight | 570.60 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | N-[4-[6-[[amino-[4-(3-fluoroazetidine-1-carbonyl)-2-methoxyanilino]methylidene]amino]-3-pyridinyl]phenyl]-2-(4-fluorophenyl)acetamide |
| SMILES | COc1cc(C(=O)N2CC(F)C2)ccc1N/C(N)=N/c1ccc(-c2ccc(NC(=O)Cc3ccc(F)cc3)cc2)cn1 |
| InChI | InChI=1S/C31H28F2N6O3/c1-42-27-15-21(30(41)39-17-24(33)18-39)6-12-26(27)37-31(34)38-28-13-7-22(16-35-28)20-4-10-25(11-5-20)36-29(40)14-19-2-8-23(32)9-3-19/h2-13,15-16,24H,14,17-18H2,1H3,(H,36,40)(H3,34,35,37,38) |
| InChIKey | HNWYKPLWGOOION-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 121.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.60 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|