C31H37FN8O4 — CID 129191658
4-[6-[[amino-[2-ethoxy-4-(morpholine-4-carbonyl)anilino]methylidene]amino]-3-pyridinyl]-N-[(4-fluorophenyl)methyl]piperazine-1-carboxamide (PubChem CID 129191658) has the molecular formula C31H37FN8O4 and a molecular weight of 604.69 g/mol. Its IUPAC name is 4-[6-[[amino-[2-ethoxy-4-(morpholine-4-carbonyl)anilino]methylidene]amino]-3-pyridinyl]-N-[(4-fluorophenyl)methyl]piperazine-1-carboxamide.
| Compound Name | 4-[6-[[amino-[2-ethoxy-4-(morpholine-4-carbonyl)anilino]methylidene]amino]-3-pyridinyl]-N-[(4-fluorophenyl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 129191658 |
| Molecular Formula | C31H37FN8O4 |
| Molecular Weight | 604.69 g/mol |
| Exact Mass | 604.29 |
| IUPAC Name | 4-[6-[[amino-[2-ethoxy-4-(morpholine-4-carbonyl)anilino]methylidene]amino]-3-pyridinyl]-N-[(4-fluorophenyl)methyl]piperazine-1-carboxamide |
| SMILES | CCOc1cc(C(=O)N2CCOCC2)ccc1N/C(N)=N/c1ccc(N2CCN(C(=O)NCc3ccc(F)cc3)CC2)cn1 |
| InChI | InChI=1S/C31H37FN8O4/c1-2-44-27-19-23(29(41)39-15-17-43-18-16-39)5-9-26(27)36-30(33)37-28-10-8-25(21-34-28)38-11-13-40(14-12-38)31(42)35-20-22-3-6-24(32)7-4-22/h3-10,19,21H,2,11-18,20H2,1H3,(H,35,42)(H3,33,34,36,37) |
| InChIKey | QDOSVCCRECWDLK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 137.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.69 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|