C22H28FN5O3 — CID 55549139
2-[(4-fluorophenyl)methylcarbamoylamino]-N-(5-morpholin-4-yl-2-pyridinyl)pentanamide (PubChem CID 55549139) has the molecular formula C22H28FN5O3 and a molecular weight of 429.50 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylcarbamoylamino]-N-(5-morpholin-4-yl-2-pyridinyl)pentanamide.
| Compound Name | 2-[(4-fluorophenyl)methylcarbamoylamino]-N-(5-morpholin-4-yl-2-pyridinyl)pentanamide |
|---|---|
| PubChem CID | 55549139 |
| Molecular Formula | C22H28FN5O3 |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 2-[(4-fluorophenyl)methylcarbamoylamino]-N-(5-morpholin-4-yl-2-pyridinyl)pentanamide |
| SMILES | CCCC(NC(=O)NCc1ccc(F)cc1)C(=O)Nc1ccc(N2CCOCC2)cn1 |
| InChI | InChI=1S/C22H28FN5O3/c1-2-3-19(26-22(30)25-14-16-4-6-17(23)7-5-16)21(29)27-20-9-8-18(15-24-20)28-10-12-31-13-11-28/h4-9,15,19H,2-3,10-14H2,1H3,(H,24,27,29)(H2,25,26,30) |
| InChIKey | AOTHHKCTHTUHBN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |