C19H23FN4O2 — CID 36714136
(2S)-2-[(4-fluorophenyl)methylcarbamoylamino]-N-(pyridin-2-ylmethyl)pentanamide (PubChem CID 36714136) has the molecular formula C19H23FN4O2 and a molecular weight of 358.42 g/mol. Its IUPAC name is (2S)-2-[(4-fluorophenyl)methylcarbamoylamino]-N-(pyridin-2-ylmethyl)pentanamide.
| Compound Name | (2S)-2-[(4-fluorophenyl)methylcarbamoylamino]-N-(pyridin-2-ylmethyl)pentanamide |
|---|---|
| PubChem CID | 36714136 |
| Molecular Formula | C19H23FN4O2 |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (2S)-2-[(4-fluorophenyl)methylcarbamoylamino]-N-(pyridin-2-ylmethyl)pentanamide |
| SMILES | CCC[C@H](NC(=O)NCc1ccc(F)cc1)C(=O)NCc1ccccn1 |
| InChI | InChI=1S/C19H23FN4O2/c1-2-5-17(18(25)22-13-16-6-3-4-11-21-16)24-19(26)23-12-14-7-9-15(20)10-8-14/h3-4,6-11,17H,2,5,12-13H2,1H3,(H,22,25)(H2,23,24,26)/t17-/m0/s1 |
| InChIKey | IFSQTKJBSIIAHH-KRWDZBQOSA-N |
| XLogP | 2.51 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |