C19H21F2N3O2 — CID 24640357
N-(4-fluorophenyl)-2-[(4-fluorophenyl)methylcarbamoylamino]pentanamide (PubChem CID 24640357) has the molecular formula C19H21F2N3O2 and a molecular weight of 361.39 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[(4-fluorophenyl)methylcarbamoylamino]pentanamide.
| Compound Name | N-(4-fluorophenyl)-2-[(4-fluorophenyl)methylcarbamoylamino]pentanamide |
|---|---|
| PubChem CID | 24640357 |
| Molecular Formula | C19H21F2N3O2 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | N-(4-fluorophenyl)-2-[(4-fluorophenyl)methylcarbamoylamino]pentanamide |
| SMILES | CCCC(NC(=O)NCc1ccc(F)cc1)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C19H21F2N3O2/c1-2-3-17(18(25)23-16-10-8-15(21)9-11-16)24-19(26)22-12-13-4-6-14(20)7-5-13/h4-11,17H,2-3,12H2,1H3,(H,23,25)(H2,22,24,26) |
| InChIKey | LRMQTABMDAWBFI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |