C17H25FN4O3 — CID 134057507
N-(2-acetamidoethyl)-2-[(4-fluorophenyl)methylcarbamoylamino]pentanamide (PubChem CID 134057507) has the molecular formula C17H25FN4O3 and a molecular weight of 352.41 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-2-[(4-fluorophenyl)methylcarbamoylamino]pentanamide.
| Compound Name | N-(2-acetamidoethyl)-2-[(4-fluorophenyl)methylcarbamoylamino]pentanamide |
|---|---|
| PubChem CID | 134057507 |
| Molecular Formula | C17H25FN4O3 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | N-(2-acetamidoethyl)-2-[(4-fluorophenyl)methylcarbamoylamino]pentanamide |
| SMILES | CCCC(NC(=O)NCc1ccc(F)cc1)C(=O)NCCNC(C)=O |
| InChI | InChI=1S/C17H25FN4O3/c1-3-4-15(16(24)20-10-9-19-12(2)23)22-17(25)21-11-13-5-7-14(18)8-6-13/h5-8,15H,3-4,9-11H2,1-2H3,(H,19,23)(H,20,24)(H2,21,22,25) |
| InChIKey | UVNYOHJRTRKMCJ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|