C19H29FN4O2 — CID 120602332
2-[(4-fluorophenyl)methylcarbamoylamino]-N-(2-methylpiperidin-4-yl)pentanamide (PubChem CID 120602332) has the molecular formula C19H29FN4O2 and a molecular weight of 364.47 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylcarbamoylamino]-N-(2-methylpiperidin-4-yl)pentanamide.
| Compound Name | 2-[(4-fluorophenyl)methylcarbamoylamino]-N-(2-methylpiperidin-4-yl)pentanamide |
|---|---|
| PubChem CID | 120602332 |
| Molecular Formula | C19H29FN4O2 |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 2-[(4-fluorophenyl)methylcarbamoylamino]-N-(2-methylpiperidin-4-yl)pentanamide |
| SMILES | CCCC(NC(=O)NCc1ccc(F)cc1)C(=O)NC1CCNC(C)C1 |
| InChI | InChI=1S/C19H29FN4O2/c1-3-4-17(18(25)23-16-9-10-21-13(2)11-16)24-19(26)22-12-14-5-7-15(20)8-6-14/h5-8,13,16-17,21H,3-4,9-12H2,1-2H3,(H,23,25)(H2,22,24,26) |
| InChIKey | LNOBIEKJCYLFNQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |