About 2-N-[(4-fluorophenyl)methyl]-3-N-(2-methylpiperidin-4-yl)pyrazine-2,3-dicarboxamide
2-N-[(4-fluorophenyl)methyl]-3-N-(2-methylpiperidin-4-yl)pyrazine-2,3-dicarboxamide (PubChem CID 120601681) has the molecular formula C19H22FN5O2
and a molecular weight of 371.42 g/mol. Its IUPAC name is 2-N-[(4-fluorophenyl)methyl]-3-N-(2-methylpiperidin-4-yl)pyrazine-2,3-dicarboxamide.
Molecular Properties
| Compound Name | 2-N-[(4-fluorophenyl)methyl]-3-N-(2-methylpiperidin-4-yl)pyrazine-2,3-dicarboxamide |
| PubChem CID | 120601681 |
| Molecular Formula | C19H22FN5O2 |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 2-N-[(4-fluorophenyl)methyl]-3-N-(2-methylpiperidin-4-yl)pyrazine-2,3-dicarboxamide |
| SMILES | CC1CC(NC(=O)c2nccnc2C(=O)NCc2ccc(F)cc2)CCN1 |
| InChI | InChI=1S/C19H22FN5O2/c1-12-10-15(6-7-21-12)25-19(27)17-16(22-8-9-23-17)18(26)24-11-13-2-4-14(20)5-3-13/h2-5,8-9,12,15,21H,6-7,10-11H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | TWRNFAFYSCXJSP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-N-[(4-fluorophenyl)methyl]-3-N-(2-methylpiperidin-4-yl)pyrazine-2,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-[(4-fluorophenyl)methyl]-3-N-(2-methylpiperidin-4-yl)pyrazine-2,3-dicarboxamide?
The IUPAC name of 2-N-[(4-fluorophenyl)methyl]-3-N-(2-methylpiperidin-4-yl)pyrazine-2,3-dicarboxamide (CID 120601681) is 2-N-[(4-fluorophenyl)methyl]-3-N-(2-methylpiperidin-4-yl)pyrazine-2,3-dicarboxamide.
What is the SMILES notation for 2-N-[(4-fluorophenyl)methyl]-3-N-(2-methylpiperidin-4-yl)pyrazine-2,3-dicarboxamide?
The canonical SMILES for 2-N-[(4-fluorophenyl)methyl]-3-N-(2-methylpiperidin-4-yl)pyrazine-2,3-dicarboxamide is CC1CC(NC(=O)c2nccnc2C(=O)NCc2ccc(F)cc2)CCN1.
What is the InChIKey of 2-N-[(4-fluorophenyl)methyl]-3-N-(2-methylpiperidin-4-yl)pyrazine-2,3-dicarboxamide?
The InChIKey is TWRNFAFYSCXJSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22FN5O2/c1-12-10-15(6-7-21-12)25-19(27)17-16(22-8-9-23-17)18(26)24-11-13-2-4-14(20)5-3-13/h2-5,8-9,12,15,21H,6-7,10-11H2,1H3,(H,24,26)(H,25,27).
What are the key properties of 2-N-[(4-fluorophenyl)methyl]-3-N-(2-methylpiperidin-4-yl)pyrazine-2,3-dicarboxamide?
2-N-[(4-fluorophenyl)methyl]-3-N-(2-methylpiperidin-4-yl)pyrazine-2,3-dicarboxamide has a molecular weight of 371.42 g/mol, XLogP of 1.42, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-[(4-fluorophenyl)methyl]-3-N-(2-methylpiperidin-4-yl)pyrazine-2,3-dicarboxamide is sourced from PubChem (CID 120601681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).