C16H24FN3O3 — CID 99808381
(2R)-2-[(4-fluorophenyl)methylcarbamoylamino]-N-(2-methoxyethyl)pentanamide (PubChem CID 99808381) has the molecular formula C16H24FN3O3 and a molecular weight of 325.38 g/mol. Its IUPAC name is (2R)-2-[(4-fluorophenyl)methylcarbamoylamino]-N-(2-methoxyethyl)pentanamide.
| Compound Name | (2R)-2-[(4-fluorophenyl)methylcarbamoylamino]-N-(2-methoxyethyl)pentanamide |
|---|---|
| PubChem CID | 99808381 |
| Molecular Formula | C16H24FN3O3 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | (2R)-2-[(4-fluorophenyl)methylcarbamoylamino]-N-(2-methoxyethyl)pentanamide |
| SMILES | CCC[C@@H](NC(=O)NCc1ccc(F)cc1)C(=O)NCCOC |
| InChI | InChI=1S/C16H24FN3O3/c1-3-4-14(15(21)18-9-10-23-2)20-16(22)19-11-12-5-7-13(17)8-6-12/h5-8,14H,3-4,9-11H2,1-2H3,(H,18,21)(H2,19,20,22)/t14-/m1/s1 |
| InChIKey | ATQMYKOBYZUPRQ-CQSZACIVSA-N |
| XLogP | 1.56 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|