C18H21FN6O3 — CID 46521288
1-[(4-fluorophenyl)methyl]-3-[1-oxo-1-[2-(pyrazine-2-carbonyl)hydrazinyl]pentan-2-yl]urea (PubChem CID 46521288) has the molecular formula C18H21FN6O3 and a molecular weight of 388.40 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-[1-oxo-1-[2-(pyrazine-2-carbonyl)hydrazinyl]pentan-2-yl]urea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-[1-oxo-1-[2-(pyrazine-2-carbonyl)hydrazinyl]pentan-2-yl]urea |
|---|---|
| PubChem CID | 46521288 |
| Molecular Formula | C18H21FN6O3 |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-[1-oxo-1-[2-(pyrazine-2-carbonyl)hydrazinyl]pentan-2-yl]urea |
| SMILES | CCCC(NC(=O)NCc1ccc(F)cc1)C(=O)NNC(=O)c1cnccn1 |
| InChI | InChI=1S/C18H21FN6O3/c1-2-3-14(16(26)24-25-17(27)15-11-20-8-9-21-15)23-18(28)22-10-12-4-6-13(19)7-5-12/h4-9,11,14H,2-3,10H2,1H3,(H,24,26)(H,25,27)(H2,22,23,28) |
| InChIKey | LHZSMLFGORUCBZ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 125.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|