C21H23FN4O5 — CID 55502654
1-[1-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-1-oxopentan-2-yl]-3-[(4-fluorophenyl)methyl]urea (PubChem CID 55502654) has the molecular formula C21H23FN4O5 and a molecular weight of 430.44 g/mol. Its IUPAC name is 1-[1-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-1-oxopentan-2-yl]-3-[(4-fluorophenyl)methyl]urea.
| Compound Name | 1-[1-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-1-oxopentan-2-yl]-3-[(4-fluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 55502654 |
| Molecular Formula | C21H23FN4O5 |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 1-[1-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-1-oxopentan-2-yl]-3-[(4-fluorophenyl)methyl]urea |
| SMILES | CCCC(NC(=O)NCc1ccc(F)cc1)C(=O)NNC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H23FN4O5/c1-2-3-16(24-21(29)23-11-13-4-7-15(22)8-5-13)20(28)26-25-19(27)14-6-9-17-18(10-14)31-12-30-17/h4-10,16H,2-3,11-12H2,1H3,(H,25,27)(H,26,28)(H2,23,24,29) |
| InChIKey | XLSYCZDMHZHHPP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|