C20H22FN5O5 — CID 55502907
1-[(4-fluorophenyl)methyl]-3-[1-[2-(3-nitrobenzoyl)hydrazinyl]-1-oxopentan-2-yl]urea (PubChem CID 55502907) has the molecular formula C20H22FN5O5 and a molecular weight of 431.42 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-[1-[2-(3-nitrobenzoyl)hydrazinyl]-1-oxopentan-2-yl]urea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-[1-[2-(3-nitrobenzoyl)hydrazinyl]-1-oxopentan-2-yl]urea |
|---|---|
| PubChem CID | 55502907 |
| Molecular Formula | C20H22FN5O5 |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-[1-[2-(3-nitrobenzoyl)hydrazinyl]-1-oxopentan-2-yl]urea |
| SMILES | CCCC(NC(=O)NCc1ccc(F)cc1)C(=O)NNC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H22FN5O5/c1-2-4-17(23-20(29)22-12-13-7-9-15(21)10-8-13)19(28)25-24-18(27)14-5-3-6-16(11-14)26(30)31/h3,5-11,17H,2,4,12H2,1H3,(H,24,27)(H,25,28)(H2,22,23,29) |
| InChIKey | ZHDYTXSLSLKGDM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|