C22H25FN4O5 — CID 26026086
1-[(2R)-1-[2-[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinyl]-1-oxopentan-2-yl]-3-[(4-fluorophenyl)methyl]urea (PubChem CID 26026086) has the molecular formula C22H25FN4O5 and a molecular weight of 444.46 g/mol. Its IUPAC name is 1-[(2R)-1-[2-[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinyl]-1-oxopentan-2-yl]-3-[(4-fluorophenyl)methyl]urea.
| Compound Name | 1-[(2R)-1-[2-[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinyl]-1-oxopentan-2-yl]-3-[(4-fluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 26026086 |
| Molecular Formula | C22H25FN4O5 |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 1-[(2R)-1-[2-[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinyl]-1-oxopentan-2-yl]-3-[(4-fluorophenyl)methyl]urea |
| SMILES | CCC[C@@H](NC(=O)NCc1ccc(F)cc1)C(=O)NNC(=O)[C@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C22H25FN4O5/c1-2-5-16(25-22(30)24-12-14-8-10-15(23)11-9-14)20(28)26-27-21(29)19-13-31-17-6-3-4-7-18(17)32-19/h3-4,6-11,16,19H,2,5,12-13H2,1H3,(H,26,28)(H,27,29)(H2,24,25,30)/t16-,19-/m1/s1 |
| InChIKey | NEKWZVFNUJAUAE-VQIMIIECSA-N |
| XLogP | 1.78 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|