C21H23FN4O5 — CID 95246746
N-[(2R)-1-[ethyl-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]amino]-1-oxopropan-2-yl]-3-nitrobenzamide (PubChem CID 95246746) has the molecular formula C21H23FN4O5 and a molecular weight of 430.44 g/mol. Its IUPAC name is N-[(2R)-1-[ethyl-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]amino]-1-oxopropan-2-yl]-3-nitrobenzamide.
| Compound Name | N-[(2R)-1-[ethyl-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]amino]-1-oxopropan-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 95246746 |
| Molecular Formula | C21H23FN4O5 |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | N-[(2R)-1-[ethyl-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]amino]-1-oxopropan-2-yl]-3-nitrobenzamide |
| SMILES | CCN(CC(=O)NCc1ccc(F)cc1)C(=O)[C@@H](C)NC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H23FN4O5/c1-3-25(13-19(27)23-12-15-7-9-17(22)10-8-15)21(29)14(2)24-20(28)16-5-4-6-18(11-16)26(30)31/h4-11,14H,3,12-13H2,1-2H3,(H,23,27)(H,24,28)/t14-/m1/s1 |
| InChIKey | LRGFBUZJTCOZOQ-CQSZACIVSA-N |
| XLogP | 2.02 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|