C25H27FN4O3 — CID 55679433
2-[(4-fluorophenyl)methylcarbamoylamino]-N-[3-(pyridin-2-ylmethoxy)phenyl]pentanamide (PubChem CID 55679433) has the molecular formula C25H27FN4O3 and a molecular weight of 450.51 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylcarbamoylamino]-N-[3-(pyridin-2-ylmethoxy)phenyl]pentanamide.
| Compound Name | 2-[(4-fluorophenyl)methylcarbamoylamino]-N-[3-(pyridin-2-ylmethoxy)phenyl]pentanamide |
|---|---|
| PubChem CID | 55679433 |
| Molecular Formula | C25H27FN4O3 |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 2-[(4-fluorophenyl)methylcarbamoylamino]-N-[3-(pyridin-2-ylmethoxy)phenyl]pentanamide |
| SMILES | CCCC(NC(=O)NCc1ccc(F)cc1)C(=O)Nc1cccc(OCc2ccccn2)c1 |
| InChI | InChI=1S/C25H27FN4O3/c1-2-6-23(30-25(32)28-16-18-10-12-19(26)13-11-18)24(31)29-20-8-5-9-22(15-20)33-17-21-7-3-4-14-27-21/h3-5,7-15,23H,2,6,16-17H2,1H3,(H,29,31)(H2,28,30,32) |
| InChIKey | WECRJMYEPHBALZ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |