C21H23ClFN3O4 — CID 55556722
methyl 2-chloro-5-[2-[(4-fluorophenyl)methylcarbamoylamino]pentanoylamino]benzoate (PubChem CID 55556722) has the molecular formula C21H23ClFN3O4 and a molecular weight of 435.88 g/mol. Its IUPAC name is methyl 2-chloro-5-[2-[(4-fluorophenyl)methylcarbamoylamino]pentanoylamino]benzoate.
| Compound Name | methyl 2-chloro-5-[2-[(4-fluorophenyl)methylcarbamoylamino]pentanoylamino]benzoate |
|---|---|
| PubChem CID | 55556722 |
| Molecular Formula | C21H23ClFN3O4 |
| Molecular Weight | 435.88 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | methyl 2-chloro-5-[2-[(4-fluorophenyl)methylcarbamoylamino]pentanoylamino]benzoate |
| SMILES | CCCC(NC(=O)NCc1ccc(F)cc1)C(=O)Nc1ccc(Cl)c(C(=O)OC)c1 |
| InChI | InChI=1S/C21H23ClFN3O4/c1-3-4-18(26-21(29)24-12-13-5-7-14(23)8-6-13)19(27)25-15-9-10-17(22)16(11-15)20(28)30-2/h5-11,18H,3-4,12H2,1-2H3,(H,25,27)(H2,24,26,29) |
| InChIKey | ISALLJLBBUGJFJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.88 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |