C18H26FN3O4 — CID 119228249
3-[2-[(4-fluorophenyl)methylcarbamoylamino]pentanoyl-methylamino]-2-methylpropanoic acid (PubChem CID 119228249) has the molecular formula C18H26FN3O4 and a molecular weight of 367.42 g/mol. Its IUPAC name is 3-[2-[(4-fluorophenyl)methylcarbamoylamino]pentanoyl-methylamino]-2-methylpropanoic acid.
| Compound Name | 3-[2-[(4-fluorophenyl)methylcarbamoylamino]pentanoyl-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 119228249 |
| Molecular Formula | C18H26FN3O4 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 3-[2-[(4-fluorophenyl)methylcarbamoylamino]pentanoyl-methylamino]-2-methylpropanoic acid |
| SMILES | CCCC(NC(=O)NCc1ccc(F)cc1)C(=O)N(C)CC(C)C(=O)O |
| InChI | InChI=1S/C18H26FN3O4/c1-4-5-15(16(23)22(3)11-12(2)17(24)25)21-18(26)20-10-13-6-8-14(19)9-7-13/h6-9,12,15H,4-5,10-11H2,1-3H3,(H,24,25)(H2,20,21,26) |
| InChIKey | MVUNYYHHEZAVNO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |