C31H26F4N6O3 — CID 90034274
4-[[6-[4-[[2-(4-fluorophenyl)acetyl]amino]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-3-methoxy-N-methyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 90034274) has the molecular formula C31H26F4N6O3 and a molecular weight of 606.58 g/mol. Its IUPAC name is 4-[[6-[4-[[2-(4-fluorophenyl)acetyl]amino]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-3-methoxy-N-methyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-[[6-[4-[[2-(4-fluorophenyl)acetyl]amino]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-3-methoxy-N-methyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 90034274 |
| Molecular Formula | C31H26F4N6O3 |
| Molecular Weight | 606.58 g/mol |
| Exact Mass | 606.20 |
| IUPAC Name | 4-[[6-[4-[[2-(4-fluorophenyl)acetyl]amino]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-3-methoxy-N-methyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | COc1cc(C(=O)N(C)CC(F)(F)F)ccc1Nc1nc2ccc(-c3ccc(NC(=O)Cc4ccc(F)cc4)cc3)cn2n1 |
| InChI | InChI=1S/C31H26F4N6O3/c1-40(18-31(33,34)35)29(43)21-7-13-25(26(16-21)44-2)37-30-38-27-14-8-22(17-41(27)39-30)20-5-11-24(12-6-20)36-28(42)15-19-3-9-23(32)10-4-19/h3-14,16-17H,15,18H2,1-2H3,(H,36,42)(H,37,39) |
| InChIKey | XATXPKBOQADWMH-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 100.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.58 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |