C31H23F7N6O3 — CID 89157127
4-[[6-[4-[[2-(4-fluorophenyl)acetyl]amino]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-2-(2,2,2-trifluoroethoxy)-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 89157127) has the molecular formula C31H23F7N6O3 and a molecular weight of 660.55 g/mol. Its IUPAC name is 4-[[6-[4-[[2-(4-fluorophenyl)acetyl]amino]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-2-(2,2,2-trifluoroethoxy)-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-[[6-[4-[[2-(4-fluorophenyl)acetyl]amino]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-2-(2,2,2-trifluoroethoxy)-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 89157127 |
| Molecular Formula | C31H23F7N6O3 |
| Molecular Weight | 660.55 g/mol |
| Exact Mass | 660.17 |
| IUPAC Name | 4-[[6-[4-[[2-(4-fluorophenyl)acetyl]amino]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-2-(2,2,2-trifluoroethoxy)-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(Cc1ccc(F)cc1)Nc1ccc(-c2ccc3nc(Nc4ccc(C(=O)NCC(F)(F)F)c(OCC(F)(F)F)c4)nn3c2)cc1 |
| InChI | InChI=1S/C31H23F7N6O3/c32-21-6-1-18(2-7-21)13-27(45)40-22-8-3-19(4-9-22)20-5-12-26-42-29(43-44(26)15-20)41-23-10-11-24(28(46)39-16-30(33,34)35)25(14-23)47-17-31(36,37)38/h1-12,14-15H,13,16-17H2,(H,39,46)(H,40,45)(H,41,43) |
| InChIKey | VSQDRQSVORVIMS-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.55 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |