C30H24F4N6O2 — CID 159121182
5-[[6-[4-[3-(4-fluorophenyl)-2-oxopropyl]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-4-methyl-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide (PubChem CID 159121182) has the molecular formula C30H24F4N6O2 and a molecular weight of 576.55 g/mol. Its IUPAC name is 5-[[6-[4-[3-(4-fluorophenyl)-2-oxopropyl]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-4-methyl-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide.
| Compound Name | 5-[[6-[4-[3-(4-fluorophenyl)-2-oxopropyl]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-4-methyl-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 159121182 |
| Molecular Formula | C30H24F4N6O2 |
| Molecular Weight | 576.55 g/mol |
| Exact Mass | 576.19 |
| IUPAC Name | 5-[[6-[4-[3-(4-fluorophenyl)-2-oxopropyl]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-4-methyl-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide |
| SMILES | Cc1cc(C(=O)NCC(F)(F)F)ncc1Nc1nc2ccc(-c3ccc(CC(=O)Cc4ccc(F)cc4)cc3)cn2n1 |
| InChI | InChI=1S/C30H24F4N6O2/c1-18-12-25(28(42)36-17-30(32,33)34)35-15-26(18)37-29-38-27-11-8-22(16-40(27)39-29)21-6-2-19(3-7-21)13-24(41)14-20-4-9-23(31)10-5-20/h2-12,15-16H,13-14,17H2,1H3,(H,36,42)(H,37,39) |
| InChIKey | KFSFJYGOWRJEAI-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.55 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |