C17H16BrN3O2 — CID 67517467
tert-butyl 5-bromo-3-pyridin-4-ylindazole-1-carboxylate (PubChem CID 67517467) has the molecular formula C17H16BrN3O2 and a molecular weight of 374.24 g/mol. Its IUPAC name is tert-butyl 5-bromo-3-pyridin-4-ylindazole-1-carboxylate.
| Compound Name | tert-butyl 5-bromo-3-pyridin-4-ylindazole-1-carboxylate |
|---|---|
| PubChem CID | 67517467 |
| Molecular Formula | C17H16BrN3O2 |
| Molecular Weight | 374.24 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | tert-butyl 5-bromo-3-pyridin-4-ylindazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1nc(-c2ccncc2)c2cc(Br)ccc21 |
| InChI | InChI=1S/C17H16BrN3O2/c1-17(2,3)23-16(22)21-14-5-4-12(18)10-13(14)15(20-21)11-6-8-19-9-7-11/h4-10H,1-3H3 |
| InChIKey | GWXVGUBRUMMMJV-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.24 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |