C20H21N3O3 — CID 155410624
tert-butyl 3-(3-carbamoylphenyl)-5-methylindazole-1-carboxylate (PubChem CID 155410624) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is tert-butyl 3-(3-carbamoylphenyl)-5-methylindazole-1-carboxylate.
| Compound Name | tert-butyl 3-(3-carbamoylphenyl)-5-methylindazole-1-carboxylate |
|---|---|
| PubChem CID | 155410624 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | tert-butyl 3-(3-carbamoylphenyl)-5-methylindazole-1-carboxylate |
| SMILES | Cc1ccc2c(c1)c(-c1cccc(C(N)=O)c1)nn2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H21N3O3/c1-12-8-9-16-15(10-12)17(13-6-5-7-14(11-13)18(21)24)22-23(16)19(25)26-20(2,3)4/h5-11H,1-4H3,(H2,21,24) |
| InChIKey | WLRDNAHQJLQDOQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |