C27H28N4O3 — CID 142662920
tert-butyl 5-(3-aminophenyl)-6-methyl-3-[(2-phenylacetyl)amino]indazole-1-carboxylate (PubChem CID 142662920) has the molecular formula C27H28N4O3 and a molecular weight of 456.55 g/mol. Its IUPAC name is tert-butyl 5-(3-aminophenyl)-6-methyl-3-[(2-phenylacetyl)amino]indazole-1-carboxylate.
| Compound Name | tert-butyl 5-(3-aminophenyl)-6-methyl-3-[(2-phenylacetyl)amino]indazole-1-carboxylate |
|---|---|
| PubChem CID | 142662920 |
| Molecular Formula | C27H28N4O3 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | tert-butyl 5-(3-aminophenyl)-6-methyl-3-[(2-phenylacetyl)amino]indazole-1-carboxylate |
| SMILES | Cc1cc2c(cc1-c1cccc(N)c1)c(NC(=O)Cc1ccccc1)nn2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H28N4O3/c1-17-13-23-22(16-21(17)19-11-8-12-20(28)15-19)25(30-31(23)26(33)34-27(2,3)4)29-24(32)14-18-9-6-5-7-10-18/h5-13,15-16H,14,28H2,1-4H3,(H,29,30,32) |
| InChIKey | AFFXJUMTQNFFJE-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|