C22H27N5O4 — CID 68918447
tert-butyl 3-amino-5-[2-(3-methoxyphenyl)ethylcarbamoylamino]indazole-1-carboxylate (PubChem CID 68918447) has the molecular formula C22H27N5O4 and a molecular weight of 425.49 g/mol. Its IUPAC name is tert-butyl 3-amino-5-[2-(3-methoxyphenyl)ethylcarbamoylamino]indazole-1-carboxylate.
| Compound Name | tert-butyl 3-amino-5-[2-(3-methoxyphenyl)ethylcarbamoylamino]indazole-1-carboxylate |
|---|---|
| PubChem CID | 68918447 |
| Molecular Formula | C22H27N5O4 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | tert-butyl 3-amino-5-[2-(3-methoxyphenyl)ethylcarbamoylamino]indazole-1-carboxylate |
| SMILES | COc1cccc(CCNC(=O)Nc2ccc3c(c2)c(N)nn3C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C22H27N5O4/c1-22(2,3)31-21(29)27-18-9-8-15(13-17(18)19(23)26-27)25-20(28)24-11-10-14-6-5-7-16(12-14)30-4/h5-9,12-13H,10-11H2,1-4H3,(H2,23,26)(H2,24,25,28) |
| InChIKey | BKUZIQAHEIMNFO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |