C18H30N2O2 — CID 108900991
1-[2-(3-methoxyphenyl)ethyl]-3-(2,4,4-trimethylpentan-2-yl)urea (PubChem CID 108900991) has the molecular formula C18H30N2O2 and a molecular weight of 306.45 g/mol. Its IUPAC name is 1-[2-(3-methoxyphenyl)ethyl]-3-(2,4,4-trimethylpentan-2-yl)urea.
| Compound Name | 1-[2-(3-methoxyphenyl)ethyl]-3-(2,4,4-trimethylpentan-2-yl)urea |
|---|---|
| PubChem CID | 108900991 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | 1-[2-(3-methoxyphenyl)ethyl]-3-(2,4,4-trimethylpentan-2-yl)urea |
| SMILES | COc1cccc(CCNC(=O)NC(C)(C)CC(C)(C)C)c1 |
| InChI | InChI=1S/C18H30N2O2/c1-17(2,3)13-18(4,5)20-16(21)19-11-10-14-8-7-9-15(12-14)22-6/h7-9,12H,10-11,13H2,1-6H3,(H2,19,20,21) |
| InChIKey | QEUJBBYMACBVON-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |