C17H28N2O2 — CID 108898360
1-[(3-methoxyphenyl)methyl]-3-(2,4,4-trimethylpentan-2-yl)urea (PubChem CID 108898360) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is 1-[(3-methoxyphenyl)methyl]-3-(2,4,4-trimethylpentan-2-yl)urea.
| Compound Name | 1-[(3-methoxyphenyl)methyl]-3-(2,4,4-trimethylpentan-2-yl)urea |
|---|---|
| PubChem CID | 108898360 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 1-[(3-methoxyphenyl)methyl]-3-(2,4,4-trimethylpentan-2-yl)urea |
| SMILES | COc1cccc(CNC(=O)NC(C)(C)CC(C)(C)C)c1 |
| InChI | InChI=1S/C17H28N2O2/c1-16(2,3)12-17(4,5)19-15(20)18-11-13-8-7-9-14(10-13)21-6/h7-10H,11-12H2,1-6H3,(H2,18,19,20) |
| InChIKey | KWYJTXQKQKETME-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |