C23H23BrN6O3 — CID 68738058
tert-butyl 5-(1-benzyltriazol-4-yl)-3-[(2-bromoacetyl)amino]indazole-1-carboxylate (PubChem CID 68738058) has the molecular formula C23H23BrN6O3 and a molecular weight of 511.38 g/mol. Its IUPAC name is tert-butyl 5-(1-benzyltriazol-4-yl)-3-[(2-bromoacetyl)amino]indazole-1-carboxylate.
| Compound Name | tert-butyl 5-(1-benzyltriazol-4-yl)-3-[(2-bromoacetyl)amino]indazole-1-carboxylate |
|---|---|
| PubChem CID | 68738058 |
| Molecular Formula | C23H23BrN6O3 |
| Molecular Weight | 511.38 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | tert-butyl 5-(1-benzyltriazol-4-yl)-3-[(2-bromoacetyl)amino]indazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1nc(NC(=O)CBr)c2cc(-c3cn(Cc4ccccc4)nn3)ccc21 |
| InChI | InChI=1S/C23H23BrN6O3/c1-23(2,3)33-22(32)30-19-10-9-16(11-17(19)21(27-30)25-20(31)12-24)18-14-29(28-26-18)13-15-7-5-4-6-8-15/h4-11,14H,12-13H2,1-3H3,(H,25,27,31) |
| InChIKey | PKJQEVFWRFSQDK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 103.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.38 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|