C19H20N2O3 — CID 67059747
tert-butyl 3-[4-(hydroxymethyl)phenyl]indazole-1-carboxylate (PubChem CID 67059747) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is tert-butyl 3-[4-(hydroxymethyl)phenyl]indazole-1-carboxylate.
| Compound Name | tert-butyl 3-[4-(hydroxymethyl)phenyl]indazole-1-carboxylate |
|---|---|
| PubChem CID | 67059747 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | tert-butyl 3-[4-(hydroxymethyl)phenyl]indazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1nc(-c2ccc(CO)cc2)c2ccccc21 |
| InChI | InChI=1S/C19H20N2O3/c1-19(2,3)24-18(23)21-16-7-5-4-6-15(16)17(20-21)14-10-8-13(12-22)9-11-14/h4-11,22H,12H2,1-3H3 |
| InChIKey | VRSTYEAQFKWJMH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |