C30H28N2O2 — CID 174706046
tert-butyl 3-(7,8,9,10-tetrahydrochrysen-1-yl)indazole-1-carboxylate (PubChem CID 174706046) has the molecular formula C30H28N2O2 and a molecular weight of 448.57 g/mol. Its IUPAC name is tert-butyl 3-(7,8,9,10-tetrahydrochrysen-1-yl)indazole-1-carboxylate.
| Compound Name | tert-butyl 3-(7,8,9,10-tetrahydrochrysen-1-yl)indazole-1-carboxylate |
|---|---|
| PubChem CID | 174706046 |
| Molecular Formula | C30H28N2O2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | tert-butyl 3-(7,8,9,10-tetrahydrochrysen-1-yl)indazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1nc(-c2cccc3c2ccc2c4c(ccc23)CCCC4)c2ccccc21 |
| InChI | InChI=1S/C30H28N2O2/c1-30(2,3)34-29(33)32-27-14-7-6-11-26(27)28(31-32)25-13-8-12-21-23-16-15-19-9-4-5-10-20(19)22(23)17-18-24(21)25/h6-8,11-18H,4-5,9-10H2,1-3H3 |
| InChIKey | GJCLOBOXSNABEL-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|