C29H27N5O4 — CID 166914164
tert-butyl 5-[6-amino-2-(2-formylprop-2-enyl)-1-oxo-3H-isoindol-4-yl]-3-pyridin-3-ylindazole-1-carboxylate (PubChem CID 166914164) has the molecular formula C29H27N5O4 and a molecular weight of 509.57 g/mol. Its IUPAC name is tert-butyl 5-[6-amino-2-(2-formylprop-2-enyl)-1-oxo-3H-isoindol-4-yl]-3-pyridin-3-ylindazole-1-carboxylate.
| Compound Name | tert-butyl 5-[6-amino-2-(2-formylprop-2-enyl)-1-oxo-3H-isoindol-4-yl]-3-pyridin-3-ylindazole-1-carboxylate |
|---|---|
| PubChem CID | 166914164 |
| Molecular Formula | C29H27N5O4 |
| Molecular Weight | 509.57 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | tert-butyl 5-[6-amino-2-(2-formylprop-2-enyl)-1-oxo-3H-isoindol-4-yl]-3-pyridin-3-ylindazole-1-carboxylate |
| SMILES | C=C(C=O)CN1Cc2c(cc(N)cc2-c2ccc3c(c2)c(-c2cccnc2)nn3C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C29H27N5O4/c1-17(16-35)14-33-15-24-21(11-20(30)12-22(24)27(33)36)18-7-8-25-23(10-18)26(19-6-5-9-31-13-19)32-34(25)28(37)38-29(2,3)4/h5-13,16H,1,14-15,30H2,2-4H3 |
| InChIKey | WPZMYLVRSIGXKH-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 120.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.57 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|