C27H31N5O4 — CID 162528786
tert-butyl 4-[3-[7-amino-2-(2-formylprop-2-enyl)-1-oxo-3H-isoindol-4-yl]phenyl]pyrazole-1-carboxylate;methanamine (PubChem CID 162528786) has the molecular formula C27H31N5O4 and a molecular weight of 489.58 g/mol. Its IUPAC name is tert-butyl 4-[3-[7-amino-2-(2-formylprop-2-enyl)-1-oxo-3H-isoindol-4-yl]phenyl]pyrazole-1-carboxylate;methanamine.
| Compound Name | tert-butyl 4-[3-[7-amino-2-(2-formylprop-2-enyl)-1-oxo-3H-isoindol-4-yl]phenyl]pyrazole-1-carboxylate;methanamine |
|---|---|
| PubChem CID | 162528786 |
| Molecular Formula | C27H31N5O4 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | tert-butyl 4-[3-[7-amino-2-(2-formylprop-2-enyl)-1-oxo-3H-isoindol-4-yl]phenyl]pyrazole-1-carboxylate;methanamine |
| SMILES | C=C(C=O)CN1Cc2c(-c3cccc(-c4cnn(C(=O)OC(C)(C)C)c4)c3)ccc(N)c2C1=O.CN |
| InChI | InChI=1S/C26H26N4O4.CH5N/c1-16(15-31)12-29-14-21-20(8-9-22(27)23(21)24(29)32)18-7-5-6-17(10-18)19-11-28-30(13-19)25(33)34-26(2,3)4;1-2/h5-11,13,15H,1,12,14,27H2,2-4H3;2H2,1H3 |
| InChIKey | QTXOXQIHZHWWMV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 133.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|