C27H28N4O2 — CID 162528744
2-[[5-amino-7-[4-methyl-3-(1-pyridin-3-ylethenyl)phenyl]-3-oxo-1H-isoindol-2-yl]methyl]prop-2-enal;methanamine (PubChem CID 162528744) has the molecular formula C27H28N4O2 and a molecular weight of 440.55 g/mol. Its IUPAC name is 2-[[5-amino-7-[4-methyl-3-(1-pyridin-3-ylethenyl)phenyl]-3-oxo-1H-isoindol-2-yl]methyl]prop-2-enal;methanamine.
| Compound Name | 2-[[5-amino-7-[4-methyl-3-(1-pyridin-3-ylethenyl)phenyl]-3-oxo-1H-isoindol-2-yl]methyl]prop-2-enal;methanamine |
|---|---|
| PubChem CID | 162528744 |
| Molecular Formula | C27H28N4O2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 2-[[5-amino-7-[4-methyl-3-(1-pyridin-3-ylethenyl)phenyl]-3-oxo-1H-isoindol-2-yl]methyl]prop-2-enal;methanamine |
| SMILES | C=C(C=O)CN1Cc2c(cc(N)cc2-c2ccc(C)c(C(=C)c3cccnc3)c2)C1=O.CN |
| InChI | InChI=1S/C26H23N3O2.CH5N/c1-16(15-30)13-29-14-25-23(10-21(27)11-24(25)26(29)31)19-7-6-17(2)22(9-19)18(3)20-5-4-8-28-12-20;1-2/h4-12,15H,1,3,13-14,27H2,2H3;2H2,1H3 |
| InChIKey | BZNBUJNOLCOKOP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|