C22H17N3O — CID 162529313
(Z)-2-[(3-oxo-8-pyridin-2-yl-1H-benzo[e]isoindol-2-yl)methyl]but-2-enenitrile (PubChem CID 162529313) has the molecular formula C22H17N3O and a molecular weight of 339.40 g/mol. Its IUPAC name is (Z)-2-[(3-oxo-8-pyridin-2-yl-1H-benzo[e]isoindol-2-yl)methyl]but-2-enenitrile.
| Compound Name | (Z)-2-[(3-oxo-8-pyridin-2-yl-1H-benzo[e]isoindol-2-yl)methyl]but-2-enenitrile |
|---|---|
| PubChem CID | 162529313 |
| Molecular Formula | C22H17N3O |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | (Z)-2-[(3-oxo-8-pyridin-2-yl-1H-benzo[e]isoindol-2-yl)methyl]but-2-enenitrile |
| SMILES | C/C=C(\C#N)CN1Cc2c(ccc3ccc(-c4ccccn4)cc23)C1=O |
| InChI | InChI=1S/C22H17N3O/c1-2-15(12-23)13-25-14-20-18(22(25)26)9-8-16-6-7-17(11-19(16)20)21-5-3-4-10-24-21/h2-11H,13-14H2,1H3/b15-2+ |
| InChIKey | LYWMXVXWJPSJEU-RSSMCMFDSA-N |
| XLogP | 4.33 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|