C19H15N5O — CID 162528921
2-[[7-(1-methylpyrazolo[4,3-c]pyridin-6-yl)-3-oxo-1H-isoindol-2-yl]methyl]prop-2-enenitrile (PubChem CID 162528921) has the molecular formula C19H15N5O and a molecular weight of 329.36 g/mol. Its IUPAC name is 2-[[7-(1-methylpyrazolo[4,3-c]pyridin-6-yl)-3-oxo-1H-isoindol-2-yl]methyl]prop-2-enenitrile.
| Compound Name | 2-[[7-(1-methylpyrazolo[4,3-c]pyridin-6-yl)-3-oxo-1H-isoindol-2-yl]methyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 162528921 |
| Molecular Formula | C19H15N5O |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 2-[[7-(1-methylpyrazolo[4,3-c]pyridin-6-yl)-3-oxo-1H-isoindol-2-yl]methyl]prop-2-enenitrile |
| SMILES | C=C(C#N)CN1Cc2c(cccc2-c2cc3c(cn2)cnn3C)C1=O |
| InChI | InChI=1S/C19H15N5O/c1-12(7-20)10-24-11-16-14(4-3-5-15(16)19(24)25)17-6-18-13(8-21-17)9-22-23(18)2/h3-6,8-9H,1,10-11H2,2H3 |
| InChIKey | QMUANAQHDSKYBI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 74.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|