C27H33N5O4 — CID 162529414
tert-butyl 3-methyl-5-[6-(methylamino)-2-(2-methylprop-2-enyl)-1-oxo-3H-isoindol-4-yl]indazole-1-carboxylate;formamide (PubChem CID 162529414) has the molecular formula C27H33N5O4 and a molecular weight of 491.59 g/mol. Its IUPAC name is tert-butyl 3-methyl-5-[6-(methylamino)-2-(2-methylprop-2-enyl)-1-oxo-3H-isoindol-4-yl]indazole-1-carboxylate;formamide.
| Compound Name | tert-butyl 3-methyl-5-[6-(methylamino)-2-(2-methylprop-2-enyl)-1-oxo-3H-isoindol-4-yl]indazole-1-carboxylate;formamide |
|---|---|
| PubChem CID | 162529414 |
| Molecular Formula | C27H33N5O4 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | tert-butyl 3-methyl-5-[6-(methylamino)-2-(2-methylprop-2-enyl)-1-oxo-3H-isoindol-4-yl]indazole-1-carboxylate;formamide |
| SMILES | C=C(C)CN1Cc2c(cc(NC)cc2-c2ccc3c(c2)c(C)nn3C(=O)OC(C)(C)C)C1=O.NC=O |
| InChI | InChI=1S/C26H30N4O3.CH3NO/c1-15(2)13-29-14-22-20(11-18(27-7)12-21(22)24(29)31)17-8-9-23-19(10-17)16(3)28-30(23)25(32)33-26(4,5)6;2-1-3/h8-12,27H,1,13-14H2,2-7H3;1H,(H2,2,3) |
| InChIKey | ZKFCXKOWRQBZNP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|