C28H24N4O4 — CID 162528831
tert-butyl 5-(1-oxo-2-prop-2-enoyl-3H-isoindol-4-yl)-3-pyridin-3-ylindazole-1-carboxylate (PubChem CID 162528831) has the molecular formula C28H24N4O4 and a molecular weight of 480.52 g/mol. Its IUPAC name is tert-butyl 5-(1-oxo-2-prop-2-enoyl-3H-isoindol-4-yl)-3-pyridin-3-ylindazole-1-carboxylate.
| Compound Name | tert-butyl 5-(1-oxo-2-prop-2-enoyl-3H-isoindol-4-yl)-3-pyridin-3-ylindazole-1-carboxylate |
|---|---|
| PubChem CID | 162528831 |
| Molecular Formula | C28H24N4O4 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | tert-butyl 5-(1-oxo-2-prop-2-enoyl-3H-isoindol-4-yl)-3-pyridin-3-ylindazole-1-carboxylate |
| SMILES | C=CC(=O)N1Cc2c(cccc2-c2ccc3c(c2)c(-c2cccnc2)nn3C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C28H24N4O4/c1-5-24(33)31-16-22-19(9-6-10-20(22)26(31)34)17-11-12-23-21(14-17)25(18-8-7-13-29-15-18)30-32(23)27(35)36-28(2,3)4/h5-15H,1,16H2,2-4H3 |
| InChIKey | KOWZDZWBPVDYBR-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 94.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|