C16H20N2O4 — CID 174934572
tert-butyl 3-methyl-5-(3-oxopropoxy)indazole-1-carboxylate (PubChem CID 174934572) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is tert-butyl 3-methyl-5-(3-oxopropoxy)indazole-1-carboxylate.
| Compound Name | tert-butyl 3-methyl-5-(3-oxopropoxy)indazole-1-carboxylate |
|---|---|
| PubChem CID | 174934572 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | tert-butyl 3-methyl-5-(3-oxopropoxy)indazole-1-carboxylate |
| SMILES | Cc1nn(C(=O)OC(C)(C)C)c2ccc(OCCC=O)cc12 |
| InChI | InChI=1S/C16H20N2O4/c1-11-13-10-12(21-9-5-8-19)6-7-14(13)18(17-11)15(20)22-16(2,3)4/h6-8,10H,5,9H2,1-4H3 |
| InChIKey | CPGVUQJFIXQKBF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|