C28H33BrN4O7 — CID 158397860
tert-butyl 3-(bromomethyl)-6-methoxyindazole-1-carboxylate;tert-butyl 3-formyl-6-methoxyindazole-1-carboxylate (PubChem CID 158397860) has the molecular formula C28H33BrN4O7 and a molecular weight of 617.50 g/mol. Its IUPAC name is tert-butyl 3-(bromomethyl)-6-methoxyindazole-1-carboxylate;tert-butyl 3-formyl-6-methoxyindazole-1-carboxylate.
| Compound Name | tert-butyl 3-(bromomethyl)-6-methoxyindazole-1-carboxylate;tert-butyl 3-formyl-6-methoxyindazole-1-carboxylate |
|---|---|
| PubChem CID | 158397860 |
| Molecular Formula | C28H33BrN4O7 |
| Molecular Weight | 617.50 g/mol |
| Exact Mass | 616.15 |
| IUPAC Name | tert-butyl 3-(bromomethyl)-6-methoxyindazole-1-carboxylate;tert-butyl 3-formyl-6-methoxyindazole-1-carboxylate |
| SMILES | COc1ccc2c(C=O)nn(C(=O)OC(C)(C)C)c2c1.COc1ccc2c(CBr)nn(C(=O)OC(C)(C)C)c2c1 |
| InChI | InChI=1S/C14H17BrN2O3.C14H16N2O4/c1-14(2,3)20-13(18)17-12-7-9(19-4)5-6-10(12)11(8-15)16-17;1-14(2,3)20-13(18)16-12-7-9(19-4)5-6-10(12)11(8-17)15-16/h5-7H,8H2,1-4H3;5-8H,1-4H3 |
| InChIKey | GXSSFFMMQPIVSK-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 123.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.50 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|