C18H29N3O3Si — CID 70982737
tert-butyl 3-amino-6-[tert-butyl(dimethyl)silyl]oxyindazole-1-carboxylate (PubChem CID 70982737) has the molecular formula C18H29N3O3Si and a molecular weight of 363.53 g/mol. Its IUPAC name is tert-butyl 3-amino-6-[tert-butyl(dimethyl)silyl]oxyindazole-1-carboxylate.
| Compound Name | tert-butyl 3-amino-6-[tert-butyl(dimethyl)silyl]oxyindazole-1-carboxylate |
|---|---|
| PubChem CID | 70982737 |
| Molecular Formula | C18H29N3O3Si |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | tert-butyl 3-amino-6-[tert-butyl(dimethyl)silyl]oxyindazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1nc(N)c2ccc(O[Si](C)(C)C(C)(C)C)cc21 |
| InChI | InChI=1S/C18H29N3O3Si/c1-17(2,3)23-16(22)21-14-11-12(9-10-13(14)15(19)20-21)24-25(7,8)18(4,5)6/h9-11H,1-8H3,(H2,19,20) |
| InChIKey | IZGVBGPQTOBTFJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|