C19H19ClFN3O2 — CID 163666539
tert-butyl 3-amino-6-[(2-chloro-6-fluorophenyl)methyl]indazole-1-carboxylate (PubChem CID 163666539) has the molecular formula C19H19ClFN3O2 and a molecular weight of 375.83 g/mol. Its IUPAC name is tert-butyl 3-amino-6-[(2-chloro-6-fluorophenyl)methyl]indazole-1-carboxylate.
| Compound Name | tert-butyl 3-amino-6-[(2-chloro-6-fluorophenyl)methyl]indazole-1-carboxylate |
|---|---|
| PubChem CID | 163666539 |
| Molecular Formula | C19H19ClFN3O2 |
| Molecular Weight | 375.83 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | tert-butyl 3-amino-6-[(2-chloro-6-fluorophenyl)methyl]indazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1nc(N)c2ccc(Cc3c(F)cccc3Cl)cc21 |
| InChI | InChI=1S/C19H19ClFN3O2/c1-19(2,3)26-18(25)24-16-10-11(7-8-12(16)17(22)23-24)9-13-14(20)5-4-6-15(13)21/h4-8,10H,9H2,1-3H3,(H2,22,23) |
| InChIKey | IYYVQEHRQSGUDN-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.83 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |