C22H24Cl2N4O3 — CID 118237099
tert-butyl N-[[2-[1-[(2,6-dichlorophenyl)methyl]-3-methylindazol-6-yl]acetyl]amino]carbamate (PubChem CID 118237099) has the molecular formula C22H24Cl2N4O3 and a molecular weight of 463.37 g/mol. Its IUPAC name is tert-butyl N-[[2-[1-[(2,6-dichlorophenyl)methyl]-3-methylindazol-6-yl]acetyl]amino]carbamate.
| Compound Name | tert-butyl N-[[2-[1-[(2,6-dichlorophenyl)methyl]-3-methylindazol-6-yl]acetyl]amino]carbamate |
|---|---|
| PubChem CID | 118237099 |
| Molecular Formula | C22H24Cl2N4O3 |
| Molecular Weight | 463.37 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | tert-butyl N-[[2-[1-[(2,6-dichlorophenyl)methyl]-3-methylindazol-6-yl]acetyl]amino]carbamate |
| SMILES | Cc1nn(Cc2c(Cl)cccc2Cl)c2cc(CC(=O)NNC(=O)OC(C)(C)C)ccc12 |
| InChI | InChI=1S/C22H24Cl2N4O3/c1-13-15-9-8-14(11-20(29)25-26-21(30)31-22(2,3)4)10-19(15)28(27-13)12-16-17(23)6-5-7-18(16)24/h5-10H,11-12H2,1-4H3,(H,25,29)(H,26,30) |
| InChIKey | WFQHRCWPIHRRBL-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.37 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|