About [[1-[(2,6-dichlorophenyl)methyl]-3-methylindazol-6-yl]-(2H-tetrazol-5-yl)methyl] acetate
[[1-[(2,6-dichlorophenyl)methyl]-3-methylindazol-6-yl]-(2H-tetrazol-5-yl)methyl] acetate (PubChem CID 118120943) has the molecular formula C19H16Cl2N6O2
and a molecular weight of 431.28 g/mol. Its IUPAC name is [[1-[(2,6-dichlorophenyl)methyl]-3-methylindazol-6-yl]-(2H-tetrazol-5-yl)methyl] acetate.
Molecular Properties
| Compound Name | [[1-[(2,6-dichlorophenyl)methyl]-3-methylindazol-6-yl]-(2H-tetrazol-5-yl)methyl] acetate |
| PubChem CID | 118120943 |
| Molecular Formula | C19H16Cl2N6O2 |
| Molecular Weight | 431.28 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | [[1-[(2,6-dichlorophenyl)methyl]-3-methylindazol-6-yl]-(2H-tetrazol-5-yl)methyl] acetate |
| SMILES | CC(=O)OC(c1ccc2c(C)nn(Cc3c(Cl)cccc3Cl)c2c1)c1nn[nH]n1 |
| InChI | InChI=1S/C19H16Cl2N6O2/c1-10-13-7-6-12(18(29-11(2)28)19-22-25-26-23-19)8-17(13)27(24-10)9-14-15(20)4-3-5-16(14)21/h3-8,18H,9H2,1-2H3,(H,22,23,25,26) |
| InChIKey | BSNWLCZRRFKUDS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.28 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [[1-[(2,6-dichlorophenyl)methyl]-3-methylindazol-6-yl]-(2H-tetrazol-5-yl)methyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[1-[(2,6-dichlorophenyl)methyl]-3-methylindazol-6-yl]-(2H-tetrazol-5-yl)methyl] acetate?
The IUPAC name of [[1-[(2,6-dichlorophenyl)methyl]-3-methylindazol-6-yl]-(2H-tetrazol-5-yl)methyl] acetate (CID 118120943) is [[1-[(2,6-dichlorophenyl)methyl]-3-methylindazol-6-yl]-(2H-tetrazol-5-yl)methyl] acetate.
What is the SMILES notation for [[1-[(2,6-dichlorophenyl)methyl]-3-methylindazol-6-yl]-(2H-tetrazol-5-yl)methyl] acetate?
The canonical SMILES for [[1-[(2,6-dichlorophenyl)methyl]-3-methylindazol-6-yl]-(2H-tetrazol-5-yl)methyl] acetate is CC(=O)OC(c1ccc2c(C)nn(Cc3c(Cl)cccc3Cl)c2c1)c1nn[nH]n1.
What is the InChIKey of [[1-[(2,6-dichlorophenyl)methyl]-3-methylindazol-6-yl]-(2H-tetrazol-5-yl)methyl] acetate?
The InChIKey is BSNWLCZRRFKUDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16Cl2N6O2/c1-10-13-7-6-12(18(29-11(2)28)19-22-25-26-23-19)8-17(13)27(24-10)9-14-15(20)4-3-5-16(14)21/h3-8,18H,9H2,1-2H3,(H,22,23,25,26).
What are the key properties of [[1-[(2,6-dichlorophenyl)methyl]-3-methylindazol-6-yl]-(2H-tetrazol-5-yl)methyl] acetate?
[[1-[(2,6-dichlorophenyl)methyl]-3-methylindazol-6-yl]-(2H-tetrazol-5-yl)methyl] acetate has a molecular weight of 431.28 g/mol, XLogP of 3.87, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [[1-[(2,6-dichlorophenyl)methyl]-3-methylindazol-6-yl]-(2H-tetrazol-5-yl)methyl] acetate is sourced from PubChem (CID 118120943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).