C17H12Cl2F2KN2O2 — CID 162331827
CID 162331827 (PubChem CID 162331827) has the molecular formula C17H12Cl2F2KN2O2 and a molecular weight of 424.30 g/mol.
| Compound Name | CID 162331827 |
|---|---|
| PubChem CID | 162331827 |
| Molecular Formula | C17H12Cl2F2KN2O2 |
| Molecular Weight | 424.30 g/mol |
| Exact Mass | 422.99 |
| IUPAC Name | — |
| SMILES | Cc1nn(Cc2c(Cl)cccc2Cl)c2cc(OC(=O)C(F)F)ccc12.[K] |
| InChI | InChI=1S/C17H12Cl2F2N2O2.K/c1-9-11-6-5-10(25-17(24)16(20)21)7-15(11)23(22-9)8-12-13(18)3-2-4-14(12)19;/h2-7,16H,8H2,1H3; |
| InChIKey | RHXNYUQHNKHPCT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.30 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|