C21H30N2O4Si — CID 59336045
tert-butyl 3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-6-oxopyridazine-1-carboxylate (PubChem CID 59336045) has the molecular formula C21H30N2O4Si and a molecular weight of 402.57 g/mol. Its IUPAC name is tert-butyl 3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-6-oxopyridazine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-6-oxopyridazine-1-carboxylate |
|---|---|
| PubChem CID | 59336045 |
| Molecular Formula | C21H30N2O4Si |
| Molecular Weight | 402.57 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | tert-butyl 3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-6-oxopyridazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1nc(-c2ccc(O[Si](C)(C)C(C)(C)C)cc2)ccc1=O |
| InChI | InChI=1S/C21H30N2O4Si/c1-20(2,3)26-19(25)23-18(24)14-13-17(22-23)15-9-11-16(12-10-15)27-28(7,8)21(4,5)6/h9-14H,1-8H3 |
| InChIKey | LGYMXGFDUAZJGG-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.57 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|