C16H18BrFN2O3 — CID 89082864
tert-butyl 5-(bromomethyl)-3-(4-fluoro-3-methoxyphenyl)pyrazole-1-carboxylate (PubChem CID 89082864) has the molecular formula C16H18BrFN2O3 and a molecular weight of 385.23 g/mol. Its IUPAC name is tert-butyl 5-(bromomethyl)-3-(4-fluoro-3-methoxyphenyl)pyrazole-1-carboxylate.
| Compound Name | tert-butyl 5-(bromomethyl)-3-(4-fluoro-3-methoxyphenyl)pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 89082864 |
| Molecular Formula | C16H18BrFN2O3 |
| Molecular Weight | 385.23 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | tert-butyl 5-(bromomethyl)-3-(4-fluoro-3-methoxyphenyl)pyrazole-1-carboxylate |
| SMILES | COc1cc(-c2cc(CBr)n(C(=O)OC(C)(C)C)n2)ccc1F |
| InChI | InChI=1S/C16H18BrFN2O3/c1-16(2,3)23-15(21)20-11(9-17)8-13(19-20)10-5-6-12(18)14(7-10)22-4/h5-8H,9H2,1-4H3 |
| InChIKey | HHSOKZWYUYTWNO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.23 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|