C13H15NO3S — CID 102151559
tert-butyl 5-oxo-3-thiophen-2-yl-2H-pyrrole-1-carboxylate (PubChem CID 102151559) has the molecular formula C13H15NO3S and a molecular weight of 265.33 g/mol. Its IUPAC name is tert-butyl 5-oxo-3-thiophen-2-yl-2H-pyrrole-1-carboxylate.
| Compound Name | tert-butyl 5-oxo-3-thiophen-2-yl-2H-pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 102151559 |
| Molecular Formula | C13H15NO3S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | tert-butyl 5-oxo-3-thiophen-2-yl-2H-pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(c2cccs2)=CC1=O |
| InChI | InChI=1S/C13H15NO3S/c1-13(2,3)17-12(16)14-8-9(7-11(14)15)10-5-4-6-18-10/h4-7H,8H2,1-3H3 |
| InChIKey | XZRGFWLWVXJNRR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |